C11H14FNO4S — CID 54964068
2-[1-(3-fluorophenyl)ethylsulfamoyl]propanoic acid (PubChem CID 54964068) has the molecular formula C11H14FNO4S and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[1-(3-fluorophenyl)ethylsulfamoyl]propanoic acid.
| Compound Name | 2-[1-(3-fluorophenyl)ethylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 54964068 |
| Molecular Formula | C11H14FNO4S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-[1-(3-fluorophenyl)ethylsulfamoyl]propanoic acid |
| SMILES | CC(NS(=O)(=O)C(C)C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H14FNO4S/c1-7(9-4-3-5-10(12)6-9)13-18(16,17)8(2)11(14)15/h3-8,13H,1-2H3,(H,14,15) |
| InChIKey | QVLGIZWRNIZJLV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |