C10H6F2N2O3 — CID 54965624
1-[(3,4-difluorophenyl)methyl]imidazolidine-2,4,5-trione (PubChem CID 54965624) has the molecular formula C10H6F2N2O3 and a molecular weight of 240.16 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 54965624 |
| Molecular Formula | C10H6F2N2O3 |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1NC(=O)N(Cc2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C10H6F2N2O3/c11-6-2-1-5(3-7(6)12)4-14-9(16)8(15)13-10(14)17/h1-3H,4H2,(H,13,15,17) |
| InChIKey | BEMJGOKFFKEHPS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|