C14H20N2O — CID 54965763
1-(5-aminopentyl)-3,4-dihydroquinolin-2-one (PubChem CID 54965763) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(5-aminopentyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 1-(5-aminopentyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 54965763 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(5-aminopentyl)-3,4-dihydroquinolin-2-one |
| SMILES | NCCCCCN1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C14H20N2O/c15-10-4-1-5-11-16-13-7-3-2-6-12(13)8-9-14(16)17/h2-3,6-7H,1,4-5,8-11,15H2 |
| InChIKey | AJCUBAZLSIWYAV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|