C15H20N2 — CID 54966703
1-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidin-2-imine (PubChem CID 54966703) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidin-2-imine.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidin-2-imine |
|---|---|
| PubChem CID | 54966703 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)piperidin-2-imine |
| SMILES | [H]/N=C1\CCCCN1c1cccc2c1CCCC2 |
| InChI | InChI=1S/C15H20N2/c16-15-10-3-4-11-17(15)14-9-5-7-12-6-1-2-8-13(12)14/h5,7,9,16H,1-4,6,8,10-11H2/b16-15+ |
| InChIKey | SETVZYXSAHRYSY-FOCLMDBBSA-N |
| XLogP | 3.53 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|