C12H20N4O — CID 54967539
N-(2-cyanoethyl)-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)acetamide (PubChem CID 54967539) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)acetamide |
|---|---|
| PubChem CID | 54967539 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N-(2-cyanoethyl)-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)acetamide |
| SMILES | N#CCCNC(=O)CNC1CCN2CCCC12 |
| InChI | InChI=1S/C12H20N4O/c13-5-2-6-14-12(17)9-15-10-4-8-16-7-1-3-11(10)16/h10-11,15H,1-4,6-9H2,(H,14,17) |
| InChIKey | KJGHILMUPOHKGN-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|