C12H20N2O3 — CID 54967809
ethyl 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-2-oxoacetate (PubChem CID 54967809) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is ethyl 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-2-oxoacetate.
| Compound Name | ethyl 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-2-oxoacetate |
|---|---|
| PubChem CID | 54967809 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | ethyl 2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NC1CCN2CCCCC12 |
| InChI | InChI=1S/C12H20N2O3/c1-2-17-12(16)11(15)13-9-6-8-14-7-4-3-5-10(9)14/h9-10H,2-8H2,1H3,(H,13,15) |
| InChIKey | YDYOKIKNZYKKRC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|