C13H20N4 — CID 54968403
2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)pyridine-2,5-diamine (PubChem CID 54968403) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)pyridine-2,5-diamine.
| Compound Name | 2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 54968403 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)pyridine-2,5-diamine |
| SMILES | Nc1ccc(NC2CCN3CCCCC23)nc1 |
| InChI | InChI=1S/C13H20N4/c14-10-4-5-13(15-9-10)16-11-6-8-17-7-2-1-3-12(11)17/h4-5,9,11-12H,1-3,6-8,14H2,(H,15,16) |
| InChIKey | UQKBJXSDSBTMQS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |