[4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid

C12H12BNO2S — CID 54969034

IUPAC[4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid
SMILESOB(O)c1ccc(CSc2ccccn2)cc1
InChIInChI=1S/C12H12BNO2S/c15-13(16)11-6-4-10(5-7-11)9-17-12-3-1-2-8-14-12/h1-8,15-16H,9H2
InChIKeyXYFMOWPXRGWTOZ-UHFFFAOYSA-N
MW245.11 g/mol
LogP1.05
Rot. Bonds4

About [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid

[4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid (PubChem CID 54969034) has the molecular formula C12H12BNO2S and a molecular weight of 245.11 g/mol. Its IUPAC name is [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid.

Molecular Properties

Compound Name[4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid
PubChem CID54969034
Molecular FormulaC12H12BNO2S
Molecular Weight245.11 g/mol
Exact Mass245.07
IUPAC Name[4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid
SMILESOB(O)c1ccc(CSc2ccccn2)cc1
InChIInChI=1S/C12H12BNO2S/c15-13(16)11-6-4-10(5-7-11)9-17-12-3-1-2-8-14-12/h1-8,15-16H,9H2
InChIKeyXYFMOWPXRGWTOZ-UHFFFAOYSA-N
XLogP1.05
TPSA53.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.11
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid?
The IUPAC name of [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid (CID 54969034) is [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid.
What is the SMILES notation for [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid?
The canonical SMILES for [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid is OB(O)c1ccc(CSc2ccccn2)cc1.
What is the InChIKey of [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid?
The InChIKey is XYFMOWPXRGWTOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BNO2S/c15-13(16)11-6-4-10(5-7-11)9-17-12-3-1-2-8-14-12/h1-8,15-16H,9H2.
What are the key properties of [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid?
[4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid has a molecular weight of 245.11 g/mol, XLogP of 1.05, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(pyridin-2-ylsulfanylmethyl)phenyl]boronic acid is sourced from PubChem (CID 54969034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).