About [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid
[4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid (PubChem CID 54969132) has the molecular formula C11H12BNO3S2
and a molecular weight of 281.17 g/mol. Its IUPAC name is [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid.
Molecular Properties
| Compound Name | [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid |
| PubChem CID | 54969132 |
| Molecular Formula | C11H12BNO3S2 |
| Molecular Weight | 281.17 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)cc1CSc1nccs1 |
| InChI | InChI=1S/C11H12BNO3S2/c1-16-10-3-2-9(12(14)15)6-8(10)7-18-11-13-4-5-17-11/h2-6,14-15H,7H2,1H3 |
| InChIKey | HEEAIFNQYCZNQS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid?
The IUPAC name of [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid (CID 54969132) is [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid.
What is the SMILES notation for [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid?
The canonical SMILES for [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid is COc1ccc(B(O)O)cc1CSc1nccs1.
What is the InChIKey of [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid?
The InChIKey is HEEAIFNQYCZNQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BNO3S2/c1-16-10-3-2-9(12(14)15)6-8(10)7-18-11-13-4-5-17-11/h2-6,14-15H,7H2,1H3.
What are the key properties of [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid?
[4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid has a molecular weight of 281.17 g/mol, XLogP of 1.12, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-3-(1,3-thiazol-2-ylsulfanylmethyl)phenyl]boronic acid is sourced from PubChem (CID 54969132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).