C15H22N2 — CID 54969418
3-[4-[[ethyl(propyl)amino]methyl]phenyl]prop-2-yn-1-amine (PubChem CID 54969418) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-[4-[[ethyl(propyl)amino]methyl]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[4-[[ethyl(propyl)amino]methyl]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 54969418 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-[4-[[ethyl(propyl)amino]methyl]phenyl]prop-2-yn-1-amine |
| SMILES | CCCN(CC)Cc1ccc(C#CCN)cc1 |
| InChI | InChI=1S/C15H22N2/c1-3-12-17(4-2)13-15-9-7-14(8-10-15)6-5-11-16/h7-10H,3-4,11-13,16H2,1-2H3 |
| InChIKey | ULKKMWCBPWFAEM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|