About [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid
[4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid (PubChem CID 54970589) has the molecular formula C13H17BN2O2
and a molecular weight of 244.10 g/mol. Its IUPAC name is [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid |
| PubChem CID | 54970589 |
| Molecular Formula | C13H17BN2O2 |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid |
| SMILES | Cc1nn(Cc2ccc(B(O)O)cc2)c(C)c1C |
| InChI | InChI=1S/C13H17BN2O2/c1-9-10(2)15-16(11(9)3)8-12-4-6-13(7-5-12)14(17)18/h4-7,17-18H,8H2,1-3H3 |
| InChIKey | AQHOHVFJLSRWHT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid?
The IUPAC name of [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid (CID 54970589) is [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid.
What is the SMILES notation for [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid?
The canonical SMILES for [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid is Cc1nn(Cc2ccc(B(O)O)cc2)c(C)c1C.
What is the InChIKey of [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid?
The InChIKey is AQHOHVFJLSRWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BN2O2/c1-9-10(2)15-16(11(9)3)8-12-4-6-13(7-5-12)14(17)18/h4-7,17-18H,8H2,1-3H3.
What are the key properties of [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid?
[4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid has a molecular weight of 244.10 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(3,4,5-trimethylpyrazol-1-yl)methyl]phenyl]boronic acid is sourced from PubChem (CID 54970589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).