[2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid

C13H20BNO3 — CID 54970678

IUPAC[2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid
SMILESCC1(C)CN(Cc2ccccc2B(O)O)CCO1
InChIInChI=1S/C13H20BNO3/c1-13(2)10-15(7-8-18-13)9-11-5-3-4-6-12(11)14(16)17/h3-6,16-17H,7-10H2,1-2H3
InChIKeyYAFROTNZNVCDLW-UHFFFAOYSA-N
MW249.12 g/mol
LogP-0.02
Rot. Bonds3

About [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid

[2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid (PubChem CID 54970678) has the molecular formula C13H20BNO3 and a molecular weight of 249.12 g/mol. Its IUPAC name is [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid.

Molecular Properties

Compound Name[2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid
PubChem CID54970678
Molecular FormulaC13H20BNO3
Molecular Weight249.12 g/mol
Exact Mass249.15
IUPAC Name[2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid
SMILESCC1(C)CN(Cc2ccccc2B(O)O)CCO1
InChIInChI=1S/C13H20BNO3/c1-13(2)10-15(7-8-18-13)9-11-5-3-4-6-12(11)14(16)17/h3-6,16-17H,7-10H2,1-2H3
InChIKeyYAFROTNZNVCDLW-UHFFFAOYSA-N
XLogP-0.02
TPSA52.93 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.12
LogP ≤ 5-0.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid?
The IUPAC name of [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid (CID 54970678) is [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid.
What is the SMILES notation for [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid?
The canonical SMILES for [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid is CC1(C)CN(Cc2ccccc2B(O)O)CCO1.
What is the InChIKey of [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid?
The InChIKey is YAFROTNZNVCDLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20BNO3/c1-13(2)10-15(7-8-18-13)9-11-5-3-4-6-12(11)14(16)17/h3-6,16-17H,7-10H2,1-2H3.
What are the key properties of [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid?
[2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid has a molecular weight of 249.12 g/mol, XLogP of -0.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,2-dimethylmorpholin-4-yl)methyl]phenyl]boronic acid is sourced from PubChem (CID 54970678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).