About 1-oxo-1,2-benzothiazol-3-one
1-oxo-1,2-benzothiazol-3-one (PubChem CID 5497096) has the molecular formula C7H5NO2S
and a molecular weight of 167.19 g/mol. Its IUPAC name is 1-oxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 1-oxo-1,2-benzothiazol-3-one |
| PubChem CID | 5497096 |
| Molecular Formula | C7H5NO2S |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | 1-oxo-1,2-benzothiazol-3-one |
| SMILES | O=C1NS(=O)c2ccccc21 |
| InChI | InChI=1S/C7H5NO2S/c9-7-5-3-1-2-4-6(5)11(10)8-7/h1-4H,(H,8,9) |
| InChIKey | MWXVFRCOTFIJSP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-oxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-1,2-benzothiazol-3-one?
The IUPAC name of 1-oxo-1,2-benzothiazol-3-one (CID 5497096) is 1-oxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 1-oxo-1,2-benzothiazol-3-one?
The canonical SMILES for 1-oxo-1,2-benzothiazol-3-one is O=C1NS(=O)c2ccccc21.
What is the InChIKey of 1-oxo-1,2-benzothiazol-3-one?
The InChIKey is MWXVFRCOTFIJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2S/c9-7-5-3-1-2-4-6(5)11(10)8-7/h1-4H,(H,8,9).
What are the key properties of 1-oxo-1,2-benzothiazol-3-one?
1-oxo-1,2-benzothiazol-3-one has a molecular weight of 167.19 g/mol, XLogP of 0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 5497096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).