C13H14BrNOS — CID 54971373
2-(3-bromo-4-methoxyphenyl)-1-thiophen-3-ylethanamine (PubChem CID 54971373) has the molecular formula C13H14BrNOS and a molecular weight of 312.23 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1-thiophen-3-ylethanamine.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 54971373 |
| Molecular Formula | C13H14BrNOS |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1-thiophen-3-ylethanamine |
| SMILES | COc1ccc(CC(N)c2ccsc2)cc1Br |
| InChI | InChI=1S/C13H14BrNOS/c1-16-13-3-2-9(6-11(13)14)7-12(15)10-4-5-17-8-10/h2-6,8,12H,7,15H2,1H3 |
| InChIKey | YLZQVAVQMSQDLA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |