C12H13F3N2O — CID 54972958
3-(ethylamino)-1-(2,3,4-trifluorophenyl)pyrrolidin-2-one (PubChem CID 54972958) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is 3-(ethylamino)-1-(2,3,4-trifluorophenyl)pyrrolidin-2-one.
| Compound Name | 3-(ethylamino)-1-(2,3,4-trifluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 54972958 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-(ethylamino)-1-(2,3,4-trifluorophenyl)pyrrolidin-2-one |
| SMILES | CCNC1CCN(c2ccc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C12H13F3N2O/c1-2-16-8-5-6-17(12(8)18)9-4-3-7(13)10(14)11(9)15/h3-4,8,16H,2,5-6H2,1H3 |
| InChIKey | VSLYWSZFVAOWGM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|