C10H20O6P2 — CID 549736
2-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-5,5-dimethyl-1,3,2lambda5-dioxaphosphinane 2-oxide (PubChem CID 549736) has the molecular formula C10H20O6P2 and a molecular weight of 298.21 g/mol. Its IUPAC name is 2-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-5,5-dimethyl-1,3,2lambda5-dioxaphosphinane 2-oxide.
| Compound Name | 2-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-5,5-dimethyl-1,3,2lambda5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 549736 |
| Molecular Formula | C10H20O6P2 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-(5,5-dimethyl-2-oxo-1,3,2lambda5-dioxaphosphinan-2-yl)-5,5-dimethyl-1,3,2lambda5-dioxaphosphinane 2-oxide |
| SMILES | CC1(C)COP(=O)(P2(=O)OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C10H20O6P2/c1-9(2)5-13-17(11,14-6-9)18(12)15-7-10(3,4)8-16-18/h5-8H2,1-4H3 |
| InChIKey | PFWQHDSRFLRDDN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|