About 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione
1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione (PubChem CID 549740) has the molecular formula C10H13BrO3
and a molecular weight of 261.11 g/mol. Its IUPAC name is 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione.
Molecular Properties
| Compound Name | 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione |
| PubChem CID | 549740 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC12CCC(Br)(C(=O)OC1=O)C2(C)C |
| InChI | InChI=1S/C10H13BrO3/c1-8(2)9(3)4-5-10(8,11)7(13)14-6(9)12/h4-5H2,1-3H3 |
| InChIKey | RYWWJLPKKKYWSY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione?
The IUPAC name of 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione (CID 549740) is 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione.
What is the SMILES notation for 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione?
The canonical SMILES for 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione is CC12CCC(Br)(C(=O)OC1=O)C2(C)C.
What is the InChIKey of 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione?
The InChIKey is RYWWJLPKKKYWSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrO3/c1-8(2)9(3)4-5-10(8,11)7(13)14-6(9)12/h4-5H2,1-3H3.
What are the key properties of 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione?
1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione has a molecular weight of 261.11 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione is sourced from PubChem (CID 549740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).