C11H18N4OS2 — CID 54977021
4-cyclopentyl-3-(1-oxo-1,4-thiazinan-4-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 54977021) has the molecular formula C11H18N4OS2 and a molecular weight of 286.43 g/mol. Its IUPAC name is 4-cyclopentyl-3-(1-oxo-1,4-thiazinan-4-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-cyclopentyl-3-(1-oxo-1,4-thiazinan-4-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 54977021 |
| Molecular Formula | C11H18N4OS2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-cyclopentyl-3-(1-oxo-1,4-thiazinan-4-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | O=S1CCN(c2n[nH]c(=S)n2C2CCCC2)CC1 |
| InChI | InChI=1S/C11H18N4OS2/c16-18-7-5-14(6-8-18)10-12-13-11(17)15(10)9-3-1-2-4-9/h9H,1-8H2,(H,13,17) |
| InChIKey | TUOVWRMEYXNNBX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|