About 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid
5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid (PubChem CID 54977065) has the molecular formula C11H12FNO3S
and a molecular weight of 257.29 g/mol. Its IUPAC name is 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid.
Molecular Properties
| Compound Name | 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid |
| PubChem CID | 54977065 |
| Molecular Formula | C11H12FNO3S |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1N1CCS(=O)CC1 |
| InChI | InChI=1S/C11H12FNO3S/c12-8-1-2-10(9(7-8)11(14)15)13-3-5-17(16)6-4-13/h1-2,7H,3-6H2,(H,14,15) |
| InChIKey | LFKFDCHRAURWHV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid?
The IUPAC name of 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid (CID 54977065) is 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid.
What is the SMILES notation for 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid?
The canonical SMILES for 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid is O=C(O)c1cc(F)ccc1N1CCS(=O)CC1.
What is the InChIKey of 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid?
The InChIKey is LFKFDCHRAURWHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO3S/c12-8-1-2-10(9(7-8)11(14)15)13-3-5-17(16)6-4-13/h1-2,7H,3-6H2,(H,14,15).
What are the key properties of 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid?
5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid has a molecular weight of 257.29 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-(1-oxo-1,4-thiazinan-4-yl)benzoic acid is sourced from PubChem (CID 54977065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).