C13H14F2O3 — CID 54977402
1-(3,4-difluorophenyl)-2-(oxolan-3-ylmethoxy)ethanone (PubChem CID 54977402) has the molecular formula C13H14F2O3 and a molecular weight of 256.25 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(oxolan-3-ylmethoxy)ethanone.
| Compound Name | 1-(3,4-difluorophenyl)-2-(oxolan-3-ylmethoxy)ethanone |
|---|---|
| PubChem CID | 54977402 |
| Molecular Formula | C13H14F2O3 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(oxolan-3-ylmethoxy)ethanone |
| SMILES | O=C(COCC1CCOC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H14F2O3/c14-11-2-1-10(5-12(11)15)13(16)8-18-7-9-3-4-17-6-9/h1-2,5,9H,3-4,6-8H2 |
| InChIKey | VZXSBQKCQGSHEN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |