C14H23N3 — CID 54977770
3,7-dimethyl-1-(pyridin-3-ylmethyl)-1,5-diazocane (PubChem CID 54977770) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 3,7-dimethyl-1-(pyridin-3-ylmethyl)-1,5-diazocane.
| Compound Name | 3,7-dimethyl-1-(pyridin-3-ylmethyl)-1,5-diazocane |
|---|---|
| PubChem CID | 54977770 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 3,7-dimethyl-1-(pyridin-3-ylmethyl)-1,5-diazocane |
| SMILES | CC1CNCC(C)CN(Cc2cccnc2)C1 |
| InChI | InChI=1S/C14H23N3/c1-12-6-16-7-13(2)10-17(9-12)11-14-4-3-5-15-8-14/h3-5,8,12-13,16H,6-7,9-11H2,1-2H3 |
| InChIKey | ADSFYHLVMSCPJI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |