C11H2F18N4 — CID 549779
4,6-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-1,3,5-triazin-2-amine (PubChem CID 549779) has the molecular formula C11H2F18N4 and a molecular weight of 532.13 g/mol. Its IUPAC name is 4,6-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 549779 |
| Molecular Formula | C11H2F18N4 |
| Molecular Weight | 532.13 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | 4,6-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)nc(C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C11H2F18N4/c12-6(13,14)4(7(15,16)17,8(18,19)20)1-31-2(33-3(30)32-1)5(9(21,22)23,10(24,25)26)11(27,28)29/h(H2,30,31,32,33) |
| InChIKey | TYXITMBLEVNKTM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.13 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |