About (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate
(3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate (PubChem CID 54979087) has the molecular formula C11H14N2O4
and a molecular weight of 238.24 g/mol. Its IUPAC name is (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate.
Molecular Properties
| Compound Name | (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate |
| PubChem CID | 54979087 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate |
| SMILES | NC(=O)CCOC(=O)COc1cccc(N)c1 |
| InChI | InChI=1S/C11H14N2O4/c12-8-2-1-3-9(6-8)17-7-11(15)16-5-4-10(13)14/h1-3,6H,4-5,7,12H2,(H2,13,14) |
| InChIKey | NKKBNOUQWJAUDJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate?
The IUPAC name of (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate (CID 54979087) is (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate.
What is the SMILES notation for (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate?
The canonical SMILES for (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate is NC(=O)CCOC(=O)COc1cccc(N)c1.
What is the InChIKey of (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate?
The InChIKey is NKKBNOUQWJAUDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4/c12-8-2-1-3-9(6-8)17-7-11(15)16-5-4-10(13)14/h1-3,6H,4-5,7,12H2,(H2,13,14).
What are the key properties of (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate?
(3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate has a molecular weight of 238.24 g/mol, XLogP of 0.07, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-3-oxopropyl) 2-(3-aminophenoxy)acetate is sourced from PubChem (CID 54979087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).