methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate

C12H21NO4 — CID 54979906

IUPACmethyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate
SMILESCOC(=O)CCN(C)C(=O)CCC1CCCO1
InChIInChI=1S/C12H21NO4/c1-13(8-7-12(15)16-2)11(14)6-5-10-4-3-9-17-10/h10H,3-9H2,1-2H3
InChIKeyCLAVATVFRLSORH-UHFFFAOYSA-N
MW243.30 g/mol
LogP0.97
Rot. Bonds6

About methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate

methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate (PubChem CID 54979906) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate
PubChem CID54979906
Molecular FormulaC12H21NO4
Molecular Weight243.30 g/mol
Exact Mass243.15
IUPAC Namemethyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate
SMILESCOC(=O)CCN(C)C(=O)CCC1CCCO1
InChIInChI=1S/C12H21NO4/c1-13(8-7-12(15)16-2)11(14)6-5-10-4-3-9-17-10/h10H,3-9H2,1-2H3
InChIKeyCLAVATVFRLSORH-UHFFFAOYSA-N
XLogP0.97
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.30
LogP ≤ 50.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate?
The IUPAC name of methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate (CID 54979906) is methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate.
What is the SMILES notation for methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate?
The canonical SMILES for methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate is COC(=O)CCN(C)C(=O)CCC1CCCO1.
What is the InChIKey of methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate?
The InChIKey is CLAVATVFRLSORH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4/c1-13(8-7-12(15)16-2)11(14)6-5-10-4-3-9-17-10/h10H,3-9H2,1-2H3.
What are the key properties of methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate?
methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate has a molecular weight of 243.30 g/mol, XLogP of 0.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[methyl-[3-(oxolan-2-yl)propanoyl]amino]propanoate is sourced from PubChem (CID 54979906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).