C14H18BrFN2 — CID 54980957
2-(2-azabicyclo[2.2.1]heptan-2-yl)-2-(5-bromo-2-fluorophenyl)ethanamine (PubChem CID 54980957) has the molecular formula C14H18BrFN2 and a molecular weight of 313.21 g/mol. Its IUPAC name is 2-(2-azabicyclo[2.2.1]heptan-2-yl)-2-(5-bromo-2-fluorophenyl)ethanamine.
| Compound Name | 2-(2-azabicyclo[2.2.1]heptan-2-yl)-2-(5-bromo-2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 54980957 |
| Molecular Formula | C14H18BrFN2 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-(2-azabicyclo[2.2.1]heptan-2-yl)-2-(5-bromo-2-fluorophenyl)ethanamine |
| SMILES | NCC(c1cc(Br)ccc1F)N1CC2CCC1C2 |
| InChI | InChI=1S/C14H18BrFN2/c15-10-2-4-13(16)12(6-10)14(7-17)18-8-9-1-3-11(18)5-9/h2,4,6,9,11,14H,1,3,5,7-8,17H2 |
| InChIKey | LIKGBOCVGSYGNX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |