About methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate
methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate (PubChem CID 54981352) has the molecular formula C12H22N2O4S
and a molecular weight of 290.38 g/mol. Its IUPAC name is methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate |
| PubChem CID | 54981352 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate |
| SMILES | COC(=O)C1(N2CCCNCC2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H22N2O4S/c1-18-11(15)12(3-9-19(16,17)10-4-12)14-7-2-5-13-6-8-14/h13H,2-10H2,1H3 |
| InChIKey | QIHHNSJKBHGVTO-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate?
The IUPAC name of methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate (CID 54981352) is methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate.
What is the SMILES notation for methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate?
The canonical SMILES for methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate is COC(=O)C1(N2CCCNCC2)CCS(=O)(=O)CC1.
What is the InChIKey of methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate?
The InChIKey is QIHHNSJKBHGVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O4S/c1-18-11(15)12(3-9-19(16,17)10-4-12)14-7-2-5-13-6-8-14/h13H,2-10H2,1H3.
What are the key properties of methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate?
methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate has a molecular weight of 290.38 g/mol, XLogP of -0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,4-diazepan-1-yl)-1,1-dioxothiane-4-carboxylate is sourced from PubChem (CID 54981352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).