About (4-anilino-1,1-dioxothian-4-yl)methanol
(4-anilino-1,1-dioxothian-4-yl)methanol (PubChem CID 54981355) has the molecular formula C12H17NO3S
and a molecular weight of 255.34 g/mol. Its IUPAC name is (4-anilino-1,1-dioxothian-4-yl)methanol.
Molecular Properties
| Compound Name | (4-anilino-1,1-dioxothian-4-yl)methanol |
| PubChem CID | 54981355 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (4-anilino-1,1-dioxothian-4-yl)methanol |
| SMILES | O=S1(=O)CCC(CO)(Nc2ccccc2)CC1 |
| InChI | InChI=1S/C12H17NO3S/c14-10-12(6-8-17(15,16)9-7-12)13-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2 |
| InChIKey | YZZXWHQXLKYDEY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-anilino-1,1-dioxothian-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-anilino-1,1-dioxothian-4-yl)methanol?
The IUPAC name of (4-anilino-1,1-dioxothian-4-yl)methanol (CID 54981355) is (4-anilino-1,1-dioxothian-4-yl)methanol.
What is the SMILES notation for (4-anilino-1,1-dioxothian-4-yl)methanol?
The canonical SMILES for (4-anilino-1,1-dioxothian-4-yl)methanol is O=S1(=O)CCC(CO)(Nc2ccccc2)CC1.
What is the InChIKey of (4-anilino-1,1-dioxothian-4-yl)methanol?
The InChIKey is YZZXWHQXLKYDEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3S/c14-10-12(6-8-17(15,16)9-7-12)13-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2.
What are the key properties of (4-anilino-1,1-dioxothian-4-yl)methanol?
(4-anilino-1,1-dioxothian-4-yl)methanol has a molecular weight of 255.34 g/mol, XLogP of 1.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-anilino-1,1-dioxothian-4-yl)methanol is sourced from PubChem (CID 54981355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).