About [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol
[4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol (PubChem CID 54981501) has the molecular formula C11H22N2O3S
and a molecular weight of 262.37 g/mol. Its IUPAC name is [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol.
Molecular Properties
| Compound Name | [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol |
| PubChem CID | 54981501 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol |
| SMILES | O=S1(=O)CCC(CO)(N2CCCNCC2)CC1 |
| InChI | InChI=1S/C11H22N2O3S/c14-10-11(2-8-17(15,16)9-3-11)13-6-1-4-12-5-7-13/h12,14H,1-10H2 |
| InChIKey | LIVPPEAJQPFEPH-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol?
The IUPAC name of [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol (CID 54981501) is [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol.
What is the SMILES notation for [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol?
The canonical SMILES for [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol is O=S1(=O)CCC(CO)(N2CCCNCC2)CC1.
What is the InChIKey of [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol?
The InChIKey is LIVPPEAJQPFEPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3S/c14-10-11(2-8-17(15,16)9-3-11)13-6-1-4-12-5-7-13/h12,14H,1-10H2.
What are the key properties of [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol?
[4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol has a molecular weight of 262.37 g/mol, XLogP of -0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,4-diazepan-1-yl)-1,1-dioxothian-4-yl]methanol is sourced from PubChem (CID 54981501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).