C14H22N2OS — CID 54981806
4-N,4-N,2-trimethyl-1-N-(1-oxothian-4-yl)benzene-1,4-diamine (PubChem CID 54981806) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 4-N,4-N,2-trimethyl-1-N-(1-oxothian-4-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N,2-trimethyl-1-N-(1-oxothian-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 54981806 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-N,4-N,2-trimethyl-1-N-(1-oxothian-4-yl)benzene-1,4-diamine |
| SMILES | Cc1cc(N(C)C)ccc1NC1CCS(=O)CC1 |
| InChI | InChI=1S/C14H22N2OS/c1-11-10-13(16(2)3)4-5-14(11)15-12-6-8-18(17)9-7-12/h4-5,10,12,15H,6-9H2,1-3H3 |
| InChIKey | CVZGDYQYNRQXIF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|