C13H21NOS2 — CID 54981912
N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1-oxothian-4-amine (PubChem CID 54981912) has the molecular formula C13H21NOS2 and a molecular weight of 271.45 g/mol. Its IUPAC name is N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1-oxothian-4-amine.
| Compound Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1-oxothian-4-amine |
|---|---|
| PubChem CID | 54981912 |
| Molecular Formula | C13H21NOS2 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1-oxothian-4-amine |
| SMILES | Cc1cc(C(C)NC2CCS(=O)CC2)c(C)s1 |
| InChI | InChI=1S/C13H21NOS2/c1-9-8-13(11(3)16-9)10(2)14-12-4-6-17(15)7-5-12/h8,10,12,14H,4-7H2,1-3H3 |
| InChIKey | XUSBXWCKFARKIS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |