About 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine
1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine (PubChem CID 54981949) has the molecular formula C11H12Cl3NOS
and a molecular weight of 312.65 g/mol. Its IUPAC name is 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine.
Molecular Properties
| Compound Name | 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine |
| PubChem CID | 54981949 |
| Molecular Formula | C11H12Cl3NOS |
| Molecular Weight | 312.65 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine |
| SMILES | O=S1CCC(Nc2c(Cl)cc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C11H12Cl3NOS/c12-7-5-9(13)11(10(14)6-7)15-8-1-3-17(16)4-2-8/h5-6,8,15H,1-4H2 |
| InChIKey | JJMYBBZWTRRNAI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine?
The IUPAC name of 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine (CID 54981949) is 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine.
What is the SMILES notation for 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine?
The canonical SMILES for 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine is O=S1CCC(Nc2c(Cl)cc(Cl)cc2Cl)CC1.
What is the InChIKey of 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine?
The InChIKey is JJMYBBZWTRRNAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl3NOS/c12-7-5-9(13)11(10(14)6-7)15-8-1-3-17(16)4-2-8/h5-6,8,15H,1-4H2.
What are the key properties of 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine?
1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine has a molecular weight of 312.65 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-N-(2,4,6-trichlorophenyl)thian-4-amine is sourced from PubChem (CID 54981949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).