C12H12N4OS — CID 54982080
4-carbamothioyl-N-(1H-pyrazol-4-ylmethyl)benzamide (PubChem CID 54982080) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 4-carbamothioyl-N-(1H-pyrazol-4-ylmethyl)benzamide.
| Compound Name | 4-carbamothioyl-N-(1H-pyrazol-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 54982080 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 4-carbamothioyl-N-(1H-pyrazol-4-ylmethyl)benzamide |
| SMILES | NC(=S)c1ccc(C(=O)NCc2cn[nH]c2)cc1 |
| InChI | InChI=1S/C12H12N4OS/c13-11(18)9-1-3-10(4-2-9)12(17)14-5-8-6-15-16-7-8/h1-4,6-7H,5H2,(H2,13,18)(H,14,17)(H,15,16) |
| InChIKey | PNTKXHXZOSGMJP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|