C12H26N2O2S — CID 54983034
4-(aminomethyl)-1,1-dioxo-N,N-dipropylthian-4-amine (PubChem CID 54983034) has the molecular formula C12H26N2O2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 4-(aminomethyl)-1,1-dioxo-N,N-dipropylthian-4-amine.
| Compound Name | 4-(aminomethyl)-1,1-dioxo-N,N-dipropylthian-4-amine |
|---|---|
| PubChem CID | 54983034 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 4-(aminomethyl)-1,1-dioxo-N,N-dipropylthian-4-amine |
| SMILES | CCCN(CCC)C1(CN)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H26N2O2S/c1-3-7-14(8-4-2)12(11-13)5-9-17(15,16)10-6-12/h3-11,13H2,1-2H3 |
| InChIKey | NDNLGHHZGJBCEV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |