C13H17N3O — CID 54983863
4-(4-cyanoanilino)-N,N-dimethylbutanamide (PubChem CID 54983863) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-(4-cyanoanilino)-N,N-dimethylbutanamide.
| Compound Name | 4-(4-cyanoanilino)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 54983863 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4-(4-cyanoanilino)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCNc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H17N3O/c1-16(2)13(17)4-3-9-15-12-7-5-11(10-14)6-8-12/h5-8,15H,3-4,9H2,1-2H3 |
| InChIKey | LFAOTHNLPVSSJN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|