C11H9Cl2F3N2O — CID 54984139
3,6-dichloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 54984139) has the molecular formula C11H9Cl2F3N2O and a molecular weight of 313.11 g/mol. Its IUPAC name is 3,6-dichloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 54984139 |
| Molecular Formula | C11H9Cl2F3N2O |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 3,6-dichloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | O=C(c1nc(Cl)ccc1Cl)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C11H9Cl2F3N2O/c12-7-3-4-8(13)17-9(7)10(19)18(6-1-2-6)5-11(14,15)16/h3-4,6H,1-2,5H2 |
| InChIKey | APOLUUYPCNNZDZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|