C11H13F2NO3S2 — CID 54984374
1,1-difluoro-N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-N-methylmethanesulfonamide (PubChem CID 54984374) has the molecular formula C11H13F2NO3S2 and a molecular weight of 309.36 g/mol. Its IUPAC name is 1,1-difluoro-N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-N-methylmethanesulfonamide.
| Compound Name | 1,1-difluoro-N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 54984374 |
| Molecular Formula | C11H13F2NO3S2 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 1,1-difluoro-N-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-N-methylmethanesulfonamide |
| SMILES | CN(Cc1cc(C#CCCO)cs1)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C11H13F2NO3S2/c1-14(19(16,17)11(12)13)7-10-6-9(8-18-10)4-2-3-5-15/h6,8,11,15H,3,5,7H2,1H3 |
| InChIKey | FHJWJMHYONMISZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|