C13H29N3S — CID 54985774
2-[4-[(dimethylamino)methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-amine (PubChem CID 54985774) has the molecular formula C13H29N3S and a molecular weight of 259.46 g/mol. Its IUPAC name is 2-[4-[(dimethylamino)methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-amine.
| Compound Name | 2-[4-[(dimethylamino)methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 54985774 |
| Molecular Formula | C13H29N3S |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 2-[4-[(dimethylamino)methyl]piperidin-1-yl]-4-methylsulfanylbutan-1-amine |
| SMILES | CSCCC(CN)N1CCC(CN(C)C)CC1 |
| InChI | InChI=1S/C13H29N3S/c1-15(2)11-12-4-7-16(8-5-12)13(10-14)6-9-17-3/h12-13H,4-11,14H2,1-3H3 |
| InChIKey | IKRTWUJSAOZFFC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |