C14H22ClN3 — CID 54986029
1-[1-[2-(chloromethyl)-4-pyridinyl]piperidin-4-yl]-N,N-dimethylmethanamine (PubChem CID 54986029) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 1-[1-[2-(chloromethyl)-4-pyridinyl]piperidin-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[1-[2-(chloromethyl)-4-pyridinyl]piperidin-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 54986029 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-[1-[2-(chloromethyl)-4-pyridinyl]piperidin-4-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CCN(c2ccnc(CCl)c2)CC1 |
| InChI | InChI=1S/C14H22ClN3/c1-17(2)11-12-4-7-18(8-5-12)14-3-6-16-13(9-14)10-15/h3,6,9,12H,4-5,7-8,10-11H2,1-2H3 |
| InChIKey | IUPUOBXPJYJQAS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|