C12H15F2N3O — CID 54986454
1-(4-amino-2,6-difluorophenyl)-N-methylpyrrolidine-2-carboxamide (PubChem CID 54986454) has the molecular formula C12H15F2N3O and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-(4-amino-2,6-difluorophenyl)-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-(4-amino-2,6-difluorophenyl)-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 54986454 |
| Molecular Formula | C12H15F2N3O |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-(4-amino-2,6-difluorophenyl)-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C12H15F2N3O/c1-16-12(18)10-3-2-4-17(10)11-8(13)5-7(15)6-9(11)14/h5-6,10H,2-4,15H2,1H3,(H,16,18) |
| InChIKey | ZNJRVRZEQGLKFF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|