About 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine
2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine (PubChem CID 54986887) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine |
| PubChem CID | 54986887 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine |
| SMILES | COCCN(CC(C)C)C1Cc2ccccc2C1N |
| InChI | InChI=1S/C16H26N2O/c1-12(2)11-18(8-9-19-3)15-10-13-6-4-5-7-14(13)16(15)17/h4-7,12,15-16H,8-11,17H2,1-3H3 |
| InChIKey | QNPQOKMPEZOTKQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine?
The IUPAC name of 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine (CID 54986887) is 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine.
What is the SMILES notation for 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine?
The canonical SMILES for 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine is COCCN(CC(C)C)C1Cc2ccccc2C1N.
What is the InChIKey of 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine?
The InChIKey is QNPQOKMPEZOTKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O/c1-12(2)11-18(8-9-19-3)15-10-13-6-4-5-7-14(13)16(15)17/h4-7,12,15-16H,8-11,17H2,1-3H3.
What are the key properties of 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine?
2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine has a molecular weight of 262.40 g/mol, XLogP of 2.22, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2-methoxyethyl)-2-N-(2-methylpropyl)-2,3-dihydro-1H-indene-1,2-diamine is sourced from PubChem (CID 54986887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).