About N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide
N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide (PubChem CID 54987585) has the molecular formula C14H29N3O2
and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide.
Molecular Properties
| Compound Name | N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide |
| PubChem CID | 54987585 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide |
| SMILES | CCCCC(CC)C(=O)N(CC)CC(C)/C(N)=N/O |
| InChI | InChI=1S/C14H29N3O2/c1-5-8-9-12(6-2)14(18)17(7-3)10-11(4)13(15)16-19/h11-12,19H,5-10H2,1-4H3,(H2,15,16) |
| InChIKey | NRKZXTMSZFMAES-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide?
The IUPAC name of N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide (CID 54987585) is N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide.
What is the SMILES notation for N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide?
The canonical SMILES for N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide is CCCCC(CC)C(=O)N(CC)CC(C)/C(N)=N/O.
What is the InChIKey of N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide?
The InChIKey is NRKZXTMSZFMAES-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3O2/c1-5-8-9-12(6-2)14(18)17(7-3)10-11(4)13(15)16-19/h11-12,19H,5-10H2,1-4H3,(H2,15,16).
What are the key properties of N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide?
N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide has a molecular weight of 271.40 g/mol, XLogP of 2.43, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-N,2-diethylhexanamide is sourced from PubChem (CID 54987585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).