C11H18ClN3O3 — CID 54987842
N-[(2-amino-2-oxoethyl)-cyclopentylcarbamoyl]-3-chloropropanamide (PubChem CID 54987842) has the molecular formula C11H18ClN3O3 and a molecular weight of 275.74 g/mol. Its IUPAC name is N-[(2-amino-2-oxoethyl)-cyclopentylcarbamoyl]-3-chloropropanamide.
| Compound Name | N-[(2-amino-2-oxoethyl)-cyclopentylcarbamoyl]-3-chloropropanamide |
|---|---|
| PubChem CID | 54987842 |
| Molecular Formula | C11H18ClN3O3 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-[(2-amino-2-oxoethyl)-cyclopentylcarbamoyl]-3-chloropropanamide |
| SMILES | NC(=O)CN(C(=O)NC(=O)CCCl)C1CCCC1 |
| InChI | InChI=1S/C11H18ClN3O3/c12-6-5-10(17)14-11(18)15(7-9(13)16)8-3-1-2-4-8/h8H,1-7H2,(H2,13,16)(H,14,17,18) |
| InChIKey | JWEPBRDWIIZRBZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|