C12H25N3O2S2 — CID 54988017
3-[azepan-1-ylsulfonyl(ethyl)amino]-2-methylpropanethioamide (PubChem CID 54988017) has the molecular formula C12H25N3O2S2 and a molecular weight of 307.49 g/mol. Its IUPAC name is 3-[azepan-1-ylsulfonyl(ethyl)amino]-2-methylpropanethioamide.
| Compound Name | 3-[azepan-1-ylsulfonyl(ethyl)amino]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 54988017 |
| Molecular Formula | C12H25N3O2S2 |
| Molecular Weight | 307.49 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-[azepan-1-ylsulfonyl(ethyl)amino]-2-methylpropanethioamide |
| SMILES | CCN(CC(C)C(N)=S)S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H25N3O2S2/c1-3-14(10-11(2)12(13)18)19(16,17)15-8-6-4-5-7-9-15/h11H,3-10H2,1-2H3,(H2,13,18) |
| InChIKey | HKKCSTBRYGGPCV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|