About 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile
3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile (PubChem CID 54988774) has the molecular formula C12H18N4O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile |
| PubChem CID | 54988774 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile |
| SMILES | CCN(CC(C)C#N)c1c(C=O)c(C)nn1C |
| InChI | InChI=1S/C12H18N4O/c1-5-16(7-9(2)6-13)12-11(8-17)10(3)14-15(12)4/h8-9H,5,7H2,1-4H3 |
| InChIKey | BIOZAZTVYFXDKX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile?
The IUPAC name of 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile (CID 54988774) is 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile.
What is the SMILES notation for 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile?
The canonical SMILES for 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile is CCN(CC(C)C#N)c1c(C=O)c(C)nn1C.
What is the InChIKey of 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile?
The InChIKey is BIOZAZTVYFXDKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O/c1-5-16(7-9(2)6-13)12-11(8-17)10(3)14-15(12)4/h8-9H,5,7H2,1-4H3.
What are the key properties of 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile?
3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile has a molecular weight of 234.30 g/mol, XLogP of 1.53, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl-(4-formyl-1,3-dimethylpyrazol-5-yl)amino]-2-methylpropanenitrile is sourced from PubChem (CID 54988774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).