About 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide
2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide (PubChem CID 54989057) has the molecular formula C13H20N4OS
and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide.
Molecular Properties
| Compound Name | 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide |
| PubChem CID | 54989057 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide |
| SMILES | Cc1cc(C)c(C(N)=S)c(N(CC(N)=O)C(C)C)n1 |
| InChI | InChI=1S/C13H20N4OS/c1-7(2)17(6-10(14)18)13-11(12(15)19)8(3)5-9(4)16-13/h5,7H,6H2,1-4H3,(H2,14,18)(H2,15,19) |
| InChIKey | NIXUKSLQZANCTG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide?
The IUPAC name of 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide (CID 54989057) is 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide.
What is the SMILES notation for 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide?
The canonical SMILES for 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide is Cc1cc(C)c(C(N)=S)c(N(CC(N)=O)C(C)C)n1.
What is the InChIKey of 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide?
The InChIKey is NIXUKSLQZANCTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4OS/c1-7(2)17(6-10(14)18)13-11(12(15)19)8(3)5-9(4)16-13/h5,7H,6H2,1-4H3,(H2,14,18)(H2,15,19).
What are the key properties of 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide?
2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide has a molecular weight of 280.40 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)-propan-2-ylamino]acetamide is sourced from PubChem (CID 54989057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).