C10H20F3N3O2 — CID 54989313
2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 54989313) has the molecular formula C10H20F3N3O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 54989313 |
| Molecular Formula | C10H20F3N3O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)C(CCN)C(F)(F)F |
| InChI | InChI=1S/C10H20F3N3O2/c1-16(7-9(17)15-5-6-18-2)8(3-4-14)10(11,12)13/h8H,3-7,14H2,1-2H3,(H,15,17) |
| InChIKey | CCTBUOYLAKDEDG-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|