About 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide
2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 54989313) has the molecular formula C10H20F3N3O2
and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
| PubChem CID | 54989313 |
| Molecular Formula | C10H20F3N3O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)C(CCN)C(F)(F)F |
| InChI | InChI=1S/C10H20F3N3O2/c1-16(7-9(17)15-5-6-18-2)8(3-4-14)10(11,12)13/h8H,3-7,14H2,1-2H3,(H,15,17) |
| InChIKey | CCTBUOYLAKDEDG-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide?
The IUPAC name of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide (CID 54989313) is 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide.
What is the SMILES notation for 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide?
The canonical SMILES for 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide is COCCNC(=O)CN(C)C(CCN)C(F)(F)F.
What is the InChIKey of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide?
The InChIKey is CCTBUOYLAKDEDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3N3O2/c1-16(7-9(17)15-5-6-18-2)8(3-4-14)10(11,12)13/h8H,3-7,14H2,1-2H3,(H,15,17).
What are the key properties of 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide?
2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide has a molecular weight of 271.28 g/mol, XLogP of -0.04, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,1,1-trifluorobutan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide is sourced from PubChem (CID 54989313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).