C14H20ClFN2 — CID 54989344
[1-[(2-chloro-4-fluorophenyl)methyl]-6-methylpiperidin-3-yl]methanamine (PubChem CID 54989344) has the molecular formula C14H20ClFN2 and a molecular weight of 270.78 g/mol. Its IUPAC name is [1-[(2-chloro-4-fluorophenyl)methyl]-6-methylpiperidin-3-yl]methanamine.
| Compound Name | [1-[(2-chloro-4-fluorophenyl)methyl]-6-methylpiperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 54989344 |
| Molecular Formula | C14H20ClFN2 |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [1-[(2-chloro-4-fluorophenyl)methyl]-6-methylpiperidin-3-yl]methanamine |
| SMILES | CC1CCC(CN)CN1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H20ClFN2/c1-10-2-3-11(7-17)8-18(10)9-12-4-5-13(16)6-14(12)15/h4-6,10-11H,2-3,7-9,17H2,1H3 |
| InChIKey | RDNUMZLPPYCGBT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |