About [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine
[6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine (PubChem CID 54989584) has the molecular formula C12H23F3N2O
and a molecular weight of 268.32 g/mol. Its IUPAC name is [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine |
| PubChem CID | 54989584 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine |
| SMILES | CC1CCC(CN)CN1CCCOCC(F)(F)F |
| InChI | InChI=1S/C12H23F3N2O/c1-10-3-4-11(7-16)8-17(10)5-2-6-18-9-12(13,14)15/h10-11H,2-9,16H2,1H3 |
| InChIKey | XVQPWZNRQVSVBI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine?
The IUPAC name of [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine (CID 54989584) is [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine.
What is the SMILES notation for [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine?
The canonical SMILES for [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine is CC1CCC(CN)CN1CCCOCC(F)(F)F.
What is the InChIKey of [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine?
The InChIKey is XVQPWZNRQVSVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F3N2O/c1-10-3-4-11(7-16)8-17(10)5-2-6-18-9-12(13,14)15/h10-11H,2-9,16H2,1H3.
What are the key properties of [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine?
[6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine has a molecular weight of 268.32 g/mol, XLogP of 2.01, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-3-yl]methanamine is sourced from PubChem (CID 54989584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).