C13H22N2O3 — CID 54989948
[2-[2-methoxyethyl(3-methoxypropyl)amino]-4-pyridinyl]methanol (PubChem CID 54989948) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is [2-[2-methoxyethyl(3-methoxypropyl)amino]-4-pyridinyl]methanol.
| Compound Name | [2-[2-methoxyethyl(3-methoxypropyl)amino]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 54989948 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | [2-[2-methoxyethyl(3-methoxypropyl)amino]-4-pyridinyl]methanol |
| SMILES | COCCCN(CCOC)c1cc(CO)ccn1 |
| InChI | InChI=1S/C13H22N2O3/c1-17-8-3-6-15(7-9-18-2)13-10-12(11-16)4-5-14-13/h4-5,10,16H,3,6-9,11H2,1-2H3 |
| InChIKey | FPQKNGNPUMSKMT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|