About 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol
4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 54990385) has the molecular formula C11H23NO5S
and a molecular weight of 281.37 g/mol. Its IUPAC name is 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol |
| PubChem CID | 54990385 |
| Molecular Formula | C11H23NO5S |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | COCCCN(CCOC)C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C11H23NO5S/c1-16-6-3-4-12(5-7-17-2)10-8-18(14,15)9-11(10)13/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | OLEJNBDVWQXNPF-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol (CID 54990385) is 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol is COCCCN(CCOC)C1CS(=O)(=O)CC1O.
What is the InChIKey of 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol?
The InChIKey is OLEJNBDVWQXNPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO5S/c1-16-6-3-4-12(5-7-17-2)10-8-18(14,15)9-11(10)13/h10-11,13H,3-9H2,1-2H3.
What are the key properties of 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol?
4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol has a molecular weight of 281.37 g/mol, XLogP of -0.87, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-methoxyethyl(3-methoxypropyl)amino]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 54990385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).